C16H31NO3Si — CID 171365798
2-[(1S,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxycyclopent-2-en-1-yl]-N-ethylacetamide (PubChem CID 171365798) has the molecular formula C16H31NO3Si and a molecular weight of 313.51 g/mol. Its IUPAC name is 2-[(1S,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxycyclopent-2-en-1-yl]-N-ethylacetamide.
| Compound Name | 2-[(1S,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxycyclopent-2-en-1-yl]-N-ethylacetamide |
|---|---|
| PubChem CID | 171365798 |
| Molecular Formula | C16H31NO3Si |
| Molecular Weight | 313.51 g/mol |
| Exact Mass | 313.21 |
| IUPAC Name | 2-[(1S,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxycyclopent-2-en-1-yl]-N-ethylacetamide |
| SMILES | CCNC(=O)C[C@H]1C=C[C@@H](O)[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H31NO3Si/c1-7-17-15(19)10-12-8-9-14(18)13(12)11-20-21(5,6)16(2,3)4/h8-9,12-14,18H,7,10-11H2,1-6H3,(H,17,19)/t12-,13+,14-/m1/s1 |
| InChIKey | QTGOJLKRXSSWPD-HZSPNIEDSA-N |
| XLogP | 2.70 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.51 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|