C19H39NO2Si2 — CID 171365833
2-[(1S,2S,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-trimethylsilylcyclopent-3-en-1-yl]-N-ethylacetamide (PubChem CID 171365833) has the molecular formula C19H39NO2Si2 and a molecular weight of 369.70 g/mol. Its IUPAC name is 2-[(1S,2S,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-trimethylsilylcyclopent-3-en-1-yl]-N-ethylacetamide.
| Compound Name | 2-[(1S,2S,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-trimethylsilylcyclopent-3-en-1-yl]-N-ethylacetamide |
|---|---|
| PubChem CID | 171365833 |
| Molecular Formula | C19H39NO2Si2 |
| Molecular Weight | 369.70 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | 2-[(1S,2S,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-trimethylsilylcyclopent-3-en-1-yl]-N-ethylacetamide |
| SMILES | CCNC(=O)C[C@H]1[C@@H](CO[Si](C)(C)C(C)(C)C)C=C[C@@H]1[Si](C)(C)C |
| InChI | InChI=1S/C19H39NO2Si2/c1-10-20-18(21)13-16-15(11-12-17(16)23(5,6)7)14-22-24(8,9)19(2,3)4/h11-12,15-17H,10,13-14H2,1-9H3,(H,20,21)/t15-,16+,17+/m1/s1 |
| InChIKey | TWNXBZOKQXFOPE-IKGGRYGDSA-N |
| XLogP | 5.05 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.70 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|