C36H30N4Ni — CID 171366319
6,15-bis(2,4,6-trimethylphenyl)-19,21-diaza-20,22-diazanidapentacyclo[14.2.1.12,5.17,10.111,14]docosa-1,3,5,7(21),8,10,12,14,16(19),17-decaene;nickel(2+) (PubChem CID 171366319) has the molecular formula C36H30N4Ni and a molecular weight of 577.36 g/mol. Its IUPAC name is 6,15-bis(2,4,6-trimethylphenyl)-19,21-diaza-20,22-diazanidapentacyclo[14.2.1.12,5.17,10.111,14]docosa-1,3,5,7(21),8,10,12,14,16(19),17-decaene;nickel(2+).
| Compound Name | 6,15-bis(2,4,6-trimethylphenyl)-19,21-diaza-20,22-diazanidapentacyclo[14.2.1.12,5.17,10.111,14]docosa-1,3,5,7(21),8,10,12,14,16(19),17-decaene;nickel(2+) |
|---|---|
| PubChem CID | 171366319 |
| Molecular Formula | C36H30N4Ni |
| Molecular Weight | 577.36 g/mol |
| Exact Mass | 576.18 |
| IUPAC Name | 6,15-bis(2,4,6-trimethylphenyl)-19,21-diaza-20,22-diazanidapentacyclo[14.2.1.12,5.17,10.111,14]docosa-1,3,5,7(21),8,10,12,14,16(19),17-decaene;nickel(2+) |
| SMILES | Cc1cc(C)c(/C2=c3\cc/c([n-]3)=C3\C=CC(=N3)/C(c3c(C)cc(C)cc3C)=c3/cc/c([n-]3)=C3\C=CC2=N3)c(C)c1.[Ni+2] |
| InChI | InChI=1S/C36H30N4.Ni/c1-19-15-21(3)33(22(4)16-19)35-29-11-7-25(37-29)27-9-13-31(39-27)36(34-23(5)17-20(2)18-24(34)6)32-14-10-28(40-32)26-8-12-30(35)38-26;/h7-18H,1-6H3;/q-2;+2/b27-25-,28-26-,35-29+,35-30+,36-31+,36-32+; |
| InChIKey | LKZRDWIUSPJKEL-WJYAANHPSA-N |
| XLogP | 3.80 |
| TPSA | 52.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.36 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |