C8H6Br2N2O2 — CID 171367362
ethyl 2,4-dibromo-5-cyano-1H-pyrrole-3-carboxylate (PubChem CID 171367362) has the molecular formula C8H6Br2N2O2 and a molecular weight of 321.96 g/mol. Its IUPAC name is ethyl 2,4-dibromo-5-cyano-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 2,4-dibromo-5-cyano-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 171367362 |
| Molecular Formula | C8H6Br2N2O2 |
| Molecular Weight | 321.96 g/mol |
| Exact Mass | 319.88 |
| IUPAC Name | ethyl 2,4-dibromo-5-cyano-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(Br)[nH]c(C#N)c1Br |
| InChI | InChI=1S/C8H6Br2N2O2/c1-2-14-8(13)5-6(9)4(3-11)12-7(5)10/h12H,2H2,1H3 |
| InChIKey | PFKOVNMBZUXOOQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.96 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |