C9H2BrCl2F5O — CID 171367690
1-(3-bromo-2,6-dichlorophenyl)-2,2,3,3,3-pentafluoropropan-1-one (PubChem CID 171367690) has the molecular formula C9H2BrCl2F5O and a molecular weight of 371.91 g/mol. Its IUPAC name is 1-(3-bromo-2,6-dichlorophenyl)-2,2,3,3,3-pentafluoropropan-1-one.
| Compound Name | 1-(3-bromo-2,6-dichlorophenyl)-2,2,3,3,3-pentafluoropropan-1-one |
|---|---|
| PubChem CID | 171367690 |
| Molecular Formula | C9H2BrCl2F5O |
| Molecular Weight | 371.91 g/mol |
| Exact Mass | 369.86 |
| IUPAC Name | 1-(3-bromo-2,6-dichlorophenyl)-2,2,3,3,3-pentafluoropropan-1-one |
| SMILES | O=C(c1c(Cl)ccc(Br)c1Cl)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H2BrCl2F5O/c10-3-1-2-4(11)5(6(3)12)7(18)8(13,14)9(15,16)17/h1-2H |
| InChIKey | SEHBHRFTVSZOKD-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.91 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|