About 2-(4-fluoro-3-methylsulfanylphenyl)-2-methyl-1,3-dioxolane
2-(4-fluoro-3-methylsulfanylphenyl)-2-methyl-1,3-dioxolane (PubChem CID 171367712) has the molecular formula C11H13FO2S
and a molecular weight of 228.29 g/mol. Its IUPAC name is 2-(4-fluoro-3-methylsulfanylphenyl)-2-methyl-1,3-dioxolane.
Molecular Properties
| Compound Name | 2-(4-fluoro-3-methylsulfanylphenyl)-2-methyl-1,3-dioxolane |
| PubChem CID | 171367712 |
| Molecular Formula | C11H13FO2S |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 2-(4-fluoro-3-methylsulfanylphenyl)-2-methyl-1,3-dioxolane |
| SMILES | CSc1cc(C2(C)OCCO2)ccc1F |
| InChI | InChI=1S/C11H13FO2S/c1-11(13-5-6-14-11)8-3-4-9(12)10(7-8)15-2/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | KOYDPABCJFAYFQ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-fluoro-3-methylsulfanylphenyl)-2-methyl-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluoro-3-methylsulfanylphenyl)-2-methyl-1,3-dioxolane?
The IUPAC name of 2-(4-fluoro-3-methylsulfanylphenyl)-2-methyl-1,3-dioxolane (CID 171367712) is 2-(4-fluoro-3-methylsulfanylphenyl)-2-methyl-1,3-dioxolane.
What is the SMILES notation for 2-(4-fluoro-3-methylsulfanylphenyl)-2-methyl-1,3-dioxolane?
The canonical SMILES for 2-(4-fluoro-3-methylsulfanylphenyl)-2-methyl-1,3-dioxolane is CSc1cc(C2(C)OCCO2)ccc1F.
What is the InChIKey of 2-(4-fluoro-3-methylsulfanylphenyl)-2-methyl-1,3-dioxolane?
The InChIKey is KOYDPABCJFAYFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13FO2S/c1-11(13-5-6-14-11)8-3-4-9(12)10(7-8)15-2/h3-4,7H,5-6H2,1-2H3.
What are the key properties of 2-(4-fluoro-3-methylsulfanylphenyl)-2-methyl-1,3-dioxolane?
2-(4-fluoro-3-methylsulfanylphenyl)-2-methyl-1,3-dioxolane has a molecular weight of 228.29 g/mol, XLogP of 2.77, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluoro-3-methylsulfanylphenyl)-2-methyl-1,3-dioxolane is sourced from PubChem (CID 171367712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).