C19H14F3N5O2 — CID 171368686
5-[8-[(1S,2S)-2-(2,3,4-trifluorophenyl)cyclopropyl]imidazo[1,2-b]pyridazin-6-yl]-1,3-diazinane-2,4-dione (PubChem CID 171368686) has the molecular formula C19H14F3N5O2 and a molecular weight of 401.35 g/mol. Its IUPAC name is 5-[8-[(1S,2S)-2-(2,3,4-trifluorophenyl)cyclopropyl]imidazo[1,2-b]pyridazin-6-yl]-1,3-diazinane-2,4-dione.
| Compound Name | 5-[8-[(1S,2S)-2-(2,3,4-trifluorophenyl)cyclopropyl]imidazo[1,2-b]pyridazin-6-yl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 171368686 |
| Molecular Formula | C19H14F3N5O2 |
| Molecular Weight | 401.35 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 5-[8-[(1S,2S)-2-(2,3,4-trifluorophenyl)cyclopropyl]imidazo[1,2-b]pyridazin-6-yl]-1,3-diazinane-2,4-dione |
| SMILES | O=C1NCC(c2cc([C@H]3C[C@@H]3c3ccc(F)c(F)c3F)c3nccn3n2)C(=O)N1 |
| InChI | InChI=1S/C19H14F3N5O2/c20-13-2-1-8(15(21)16(13)22)9-5-10(9)11-6-14(26-27-4-3-23-17(11)27)12-7-24-19(29)25-18(12)28/h1-4,6,9-10,12H,5,7H2,(H2,24,25,28,29)/t9-,10+,12?/m1/s1 |
| InChIKey | XXAHVTAGICWFQV-WFCWDVHWSA-N |
| XLogP | 2.34 |
| TPSA | 88.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|