C20H14F2N6O2 — CID 171368772
4-[(1S,2S)-2-[6-(2,4-dioxo-1,3-diazinan-5-yl)imidazo[1,2-b]pyridazin-8-yl]cyclopropyl]-2,6-difluorobenzonitrile (PubChem CID 171368772) has the molecular formula C20H14F2N6O2 and a molecular weight of 408.37 g/mol. Its IUPAC name is 4-[(1S,2S)-2-[6-(2,4-dioxo-1,3-diazinan-5-yl)imidazo[1,2-b]pyridazin-8-yl]cyclopropyl]-2,6-difluorobenzonitrile.
| Compound Name | 4-[(1S,2S)-2-[6-(2,4-dioxo-1,3-diazinan-5-yl)imidazo[1,2-b]pyridazin-8-yl]cyclopropyl]-2,6-difluorobenzonitrile |
|---|---|
| PubChem CID | 171368772 |
| Molecular Formula | C20H14F2N6O2 |
| Molecular Weight | 408.37 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 4-[(1S,2S)-2-[6-(2,4-dioxo-1,3-diazinan-5-yl)imidazo[1,2-b]pyridazin-8-yl]cyclopropyl]-2,6-difluorobenzonitrile |
| SMILES | N#Cc1c(F)cc([C@H]2C[C@@H]2c2cc(C3CNC(=O)NC3=O)nn3ccnc23)cc1F |
| InChI | InChI=1S/C20H14F2N6O2/c21-15-3-9(4-16(22)13(15)7-23)10-5-11(10)12-6-17(27-28-2-1-24-18(12)28)14-8-25-20(30)26-19(14)29/h1-4,6,10-11,14H,5,8H2,(H2,25,26,29,30)/t10-,11+,14?/m1/s1 |
| InChIKey | AQLKNTHDHNENSP-ZAZPPBBNSA-N |
| XLogP | 2.07 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |