C22H26N4O2S2 — CID 17137059
N-(2-butylsulfanylphenyl)-2-[[5-(methoxymethyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 17137059) has the molecular formula C22H26N4O2S2 and a molecular weight of 442.61 g/mol. Its IUPAC name is N-(2-butylsulfanylphenyl)-2-[[5-(methoxymethyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(2-butylsulfanylphenyl)-2-[[5-(methoxymethyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 17137059 |
| Molecular Formula | C22H26N4O2S2 |
| Molecular Weight | 442.61 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | N-(2-butylsulfanylphenyl)-2-[[5-(methoxymethyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CCCCSc1ccccc1NC(=O)CSc1nnc(COC)n1-c1ccccc1 |
| InChI | InChI=1S/C22H26N4O2S2/c1-3-4-14-29-19-13-9-8-12-18(19)23-21(27)16-30-22-25-24-20(15-28-2)26(22)17-10-6-5-7-11-17/h5-13H,3-4,14-16H2,1-2H3,(H,23,27) |
| InChIKey | OYLOREPLSSCECF-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.61 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|