About Bis(chlorosulfonyl)imide potassium salt
Bis(chlorosulfonyl)imide potassium salt (PubChem CID 171370683) has the molecular formula HCl2KNO4S2
and a molecular weight of 253.15 g/mol.
Molecular Properties
| Compound Name | Bis(chlorosulfonyl)imide potassium salt |
| PubChem CID | 171370683 |
| Molecular Formula | HCl2KNO4S2 |
| Molecular Weight | 253.15 g/mol |
| Exact Mass | 251.84 |
| IUPAC Name | — |
| SMILES | O=S(=O)(Cl)NS(=O)(=O)Cl.[K] |
| InChI | InChI=1S/Cl2HNO4S2.K/c1-8(4,5)3-9(2,6)7;/h3H; |
| InChIKey | GNMNANYXDRLRRW-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.15 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze Bis(chlorosulfonyl)imide potassium salt with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Bis(chlorosulfonyl)imide potassium salt?
The IUPAC name of Bis(chlorosulfonyl)imide potassium salt (CID 171370683) is not available.
What is the SMILES notation for Bis(chlorosulfonyl)imide potassium salt?
The canonical SMILES for Bis(chlorosulfonyl)imide potassium salt is O=S(=O)(Cl)NS(=O)(=O)Cl.[K].
What is the InChIKey of Bis(chlorosulfonyl)imide potassium salt?
The InChIKey is GNMNANYXDRLRRW-UHFFFAOYSA-N. The full InChI is InChI=1S/Cl2HNO4S2.K/c1-8(4,5)3-9(2,6)7;/h3H;.
What are the key properties of Bis(chlorosulfonyl)imide potassium salt?
Bis(chlorosulfonyl)imide potassium salt has a molecular weight of 253.15 g/mol, XLogP of -0.84, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Bis(chlorosulfonyl)imide potassium salt is sourced from PubChem (CID 171370683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).