About (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(4-thiophen-3-yl-1,3-thiazol-5-yl)borinic acid
(3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(4-thiophen-3-yl-1,3-thiazol-5-yl)borinic acid (PubChem CID 171371138) has the molecular formula C13H18BNO3S2
and a molecular weight of 311.24 g/mol. Its IUPAC name is (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(4-thiophen-3-yl-1,3-thiazol-5-yl)borinic acid.
Molecular Properties
| Compound Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(4-thiophen-3-yl-1,3-thiazol-5-yl)borinic acid |
| PubChem CID | 171371138 |
| Molecular Formula | C13H18BNO3S2 |
| Molecular Weight | 311.24 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(4-thiophen-3-yl-1,3-thiazol-5-yl)borinic acid |
| SMILES | CC(C)(O)C(C)(C)OB(O)c1scnc1-c1ccsc1 |
| InChI | InChI=1S/C13H18BNO3S2/c1-12(2,16)13(3,4)18-14(17)11-10(15-8-20-11)9-5-6-19-7-9/h5-8,16-17H,1-4H3 |
| InChIKey | MMWFYPRHPBCJET-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.24 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(4-thiophen-3-yl-1,3-thiazol-5-yl)borinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(4-thiophen-3-yl-1,3-thiazol-5-yl)borinic acid?
The IUPAC name of (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(4-thiophen-3-yl-1,3-thiazol-5-yl)borinic acid (CID 171371138) is (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(4-thiophen-3-yl-1,3-thiazol-5-yl)borinic acid.
What is the SMILES notation for (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(4-thiophen-3-yl-1,3-thiazol-5-yl)borinic acid?
The canonical SMILES for (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(4-thiophen-3-yl-1,3-thiazol-5-yl)borinic acid is CC(C)(O)C(C)(C)OB(O)c1scnc1-c1ccsc1.
What is the InChIKey of (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(4-thiophen-3-yl-1,3-thiazol-5-yl)borinic acid?
The InChIKey is MMWFYPRHPBCJET-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18BNO3S2/c1-12(2,16)13(3,4)18-14(17)11-10(15-8-20-11)9-5-6-19-7-9/h5-8,16-17H,1-4H3.
What are the key properties of (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(4-thiophen-3-yl-1,3-thiazol-5-yl)borinic acid?
(3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(4-thiophen-3-yl-1,3-thiazol-5-yl)borinic acid has a molecular weight of 311.24 g/mol, XLogP of 2.13, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(4-thiophen-3-yl-1,3-thiazol-5-yl)borinic acid is sourced from PubChem (CID 171371138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).