C13H17N — CID 171371589
1-(2,4,6-trimethylphenyl)-2,5-dihydropyrrole (PubChem CID 171371589) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is 1-(2,4,6-trimethylphenyl)-2,5-dihydropyrrole.
| Compound Name | 1-(2,4,6-trimethylphenyl)-2,5-dihydropyrrole |
|---|---|
| PubChem CID | 171371589 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 1-(2,4,6-trimethylphenyl)-2,5-dihydropyrrole |
| SMILES | Cc1cc(C)c(N2CC=CC2)c(C)c1 |
| InChI | InChI=1S/C13H17N/c1-10-8-11(2)13(12(3)9-10)14-6-4-5-7-14/h4-5,8-9H,6-7H2,1-3H3 |
| InChIKey | SYWQDDLZPPMBIE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|