C8H4FIN2O — CID 171373650
2-(2-fluoro-4-iodophenyl)-1,3,4-oxadiazole (PubChem CID 171373650) has the molecular formula C8H4FIN2O and a molecular weight of 290.04 g/mol. Its IUPAC name is 2-(2-fluoro-4-iodophenyl)-1,3,4-oxadiazole.
| Compound Name | 2-(2-fluoro-4-iodophenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 171373650 |
| Molecular Formula | C8H4FIN2O |
| Molecular Weight | 290.04 g/mol |
| Exact Mass | 289.94 |
| IUPAC Name | 2-(2-fluoro-4-iodophenyl)-1,3,4-oxadiazole |
| SMILES | Fc1cc(I)ccc1-c1nnco1 |
| InChI | InChI=1S/C8H4FIN2O/c9-7-3-5(10)1-2-6(7)8-12-11-4-13-8/h1-4H |
| InChIKey | RKCGFOFPSADLKY-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.04 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|