About potassium trifluoro-[(4-fluoro-3,5-dimethylphenyl)methyl]boranuide
potassium trifluoro-[(4-fluoro-3,5-dimethylphenyl)methyl]boranuide (PubChem CID 171374235) has the molecular formula C9H10BF4K
and a molecular weight of 244.08 g/mol. Its IUPAC name is potassium trifluoro-[(4-fluoro-3,5-dimethylphenyl)methyl]boranuide.
Molecular Properties
| Compound Name | potassium trifluoro-[(4-fluoro-3,5-dimethylphenyl)methyl]boranuide |
| PubChem CID | 171374235 |
| Molecular Formula | C9H10BF4K |
| Molecular Weight | 244.08 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | potassium trifluoro-[(4-fluoro-3,5-dimethylphenyl)methyl]boranuide |
| SMILES | Cc1cc(C[B-](F)(F)F)cc(C)c1F.[K+] |
| InChI | InChI=1S/C9H10BF4.K/c1-6-3-8(5-10(12,13)14)4-7(2)9(6)11;/h3-4H,5H2,1-2H3;/q-1;+1 |
| InChIKey | QZJWBVVHYKIUEH-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.08 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze potassium trifluoro-[(4-fluoro-3,5-dimethylphenyl)methyl]boranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium trifluoro-[(4-fluoro-3,5-dimethylphenyl)methyl]boranuide?
The IUPAC name of potassium trifluoro-[(4-fluoro-3,5-dimethylphenyl)methyl]boranuide (CID 171374235) is potassium trifluoro-[(4-fluoro-3,5-dimethylphenyl)methyl]boranuide.
What is the SMILES notation for potassium trifluoro-[(4-fluoro-3,5-dimethylphenyl)methyl]boranuide?
The canonical SMILES for potassium trifluoro-[(4-fluoro-3,5-dimethylphenyl)methyl]boranuide is Cc1cc(C[B-](F)(F)F)cc(C)c1F.[K+].
What is the InChIKey of potassium trifluoro-[(4-fluoro-3,5-dimethylphenyl)methyl]boranuide?
The InChIKey is QZJWBVVHYKIUEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10BF4.K/c1-6-3-8(5-10(12,13)14)4-7(2)9(6)11;/h3-4H,5H2,1-2H3;/q-1;+1.
What are the key properties of potassium trifluoro-[(4-fluoro-3,5-dimethylphenyl)methyl]boranuide?
potassium trifluoro-[(4-fluoro-3,5-dimethylphenyl)methyl]boranuide has a molecular weight of 244.08 g/mol, XLogP of 0.38, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for potassium trifluoro-[(4-fluoro-3,5-dimethylphenyl)methyl]boranuide is sourced from PubChem (CID 171374235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).