About 2-(2-chloro-5-fluorophenyl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid
2-(2-chloro-5-fluorophenyl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid (PubChem CID 171374403) has the molecular formula C10H7ClFNO2S
and a molecular weight of 259.69 g/mol. Its IUPAC name is 2-(2-chloro-5-fluorophenyl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-(2-chloro-5-fluorophenyl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
| PubChem CID | 171374403 |
| Molecular Formula | C10H7ClFNO2S |
| Molecular Weight | 259.69 g/mol |
| Exact Mass | 258.99 |
| IUPAC Name | 2-(2-chloro-5-fluorophenyl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)C1CSC(c2cc(F)ccc2Cl)=N1 |
| InChI | InChI=1S/C10H7ClFNO2S/c11-7-2-1-5(12)3-6(7)9-13-8(4-16-9)10(14)15/h1-3,8H,4H2,(H,14,15) |
| InChIKey | KFLICUDBODEBJL-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.69 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-chloro-5-fluorophenyl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-chloro-5-fluorophenyl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 2-(2-chloro-5-fluorophenyl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid (CID 171374403) is 2-(2-chloro-5-fluorophenyl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 2-(2-chloro-5-fluorophenyl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 2-(2-chloro-5-fluorophenyl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid is O=C(O)C1CSC(c2cc(F)ccc2Cl)=N1.
What is the InChIKey of 2-(2-chloro-5-fluorophenyl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid?
The InChIKey is KFLICUDBODEBJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7ClFNO2S/c11-7-2-1-5(12)3-6(7)9-13-8(4-16-9)10(14)15/h1-3,8H,4H2,(H,14,15).
What are the key properties of 2-(2-chloro-5-fluorophenyl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid?
2-(2-chloro-5-fluorophenyl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid has a molecular weight of 259.69 g/mol, XLogP of 2.43, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-chloro-5-fluorophenyl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 171374403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).