About N,N-dimethylmethanamine;chloride;hydrochloride
N,N-dimethylmethanamine;chloride;hydrochloride (PubChem CID 171375019) has the molecular formula C3H10Cl2N-
and a molecular weight of 131.03 g/mol. Its IUPAC name is N,N-dimethylmethanamine;chloride;hydrochloride.
Molecular Properties
| Compound Name | N,N-dimethylmethanamine;chloride;hydrochloride |
| PubChem CID | 171375019 |
| Molecular Formula | C3H10Cl2N- |
| Molecular Weight | 131.03 g/mol |
| Exact Mass | 130.02 |
| IUPAC Name | N,N-dimethylmethanamine;chloride;hydrochloride |
| SMILES | CN(C)C.Cl.[Cl-] |
| InChI | InChI=1S/C3H9N.2ClH/c1-4(2)3;;/h1-3H3;2*1H/p-1 |
| InChIKey | MVTBQTUWKKCHOI-UHFFFAOYSA-M |
| XLogP | -2.40 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.03 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-dimethylmethanamine;chloride;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylmethanamine;chloride;hydrochloride?
The IUPAC name of N,N-dimethylmethanamine;chloride;hydrochloride (CID 171375019) is N,N-dimethylmethanamine;chloride;hydrochloride.
What is the SMILES notation for N,N-dimethylmethanamine;chloride;hydrochloride?
The canonical SMILES for N,N-dimethylmethanamine;chloride;hydrochloride is CN(C)C.Cl.[Cl-].
What is the InChIKey of N,N-dimethylmethanamine;chloride;hydrochloride?
The InChIKey is MVTBQTUWKKCHOI-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H9N.2ClH/c1-4(2)3;;/h1-3H3;2*1H/p-1.
What are the key properties of N,N-dimethylmethanamine;chloride;hydrochloride?
N,N-dimethylmethanamine;chloride;hydrochloride has a molecular weight of 131.03 g/mol, XLogP of -2.40, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylmethanamine;chloride;hydrochloride is sourced from PubChem (CID 171375019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).