About ditert-butylphosphane;mercury(1+);chloride
ditert-butylphosphane;mercury(1+);chloride (PubChem CID 171375109) has the molecular formula C8H19ClHgP
and a molecular weight of 382.26 g/mol. Its IUPAC name is ditert-butylphosphane;mercury(1+);chloride.
Molecular Properties
| Compound Name | ditert-butylphosphane;mercury(1+);chloride |
| PubChem CID | 171375109 |
| Molecular Formula | C8H19ClHgP |
| Molecular Weight | 382.26 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | ditert-butylphosphane;mercury(1+);chloride |
| SMILES | CC(C)(C)PC(C)(C)C.[Cl-].[Hg+] |
| InChI | InChI=1S/C8H19P.ClH.Hg/c1-7(2,3)9-8(4,5)6;;/h9H,1-6H3;1H;/q;;+1/p-1 |
| InChIKey | ZZNFDBRSNVZCLO-UHFFFAOYSA-M |
| XLogP | 0.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.26 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ditert-butylphosphane;mercury(1+);chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butylphosphane;mercury(1+);chloride?
The IUPAC name of ditert-butylphosphane;mercury(1+);chloride (CID 171375109) is ditert-butylphosphane;mercury(1+);chloride.
What is the SMILES notation for ditert-butylphosphane;mercury(1+);chloride?
The canonical SMILES for ditert-butylphosphane;mercury(1+);chloride is CC(C)(C)PC(C)(C)C.[Cl-].[Hg+].
What is the InChIKey of ditert-butylphosphane;mercury(1+);chloride?
The InChIKey is ZZNFDBRSNVZCLO-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H19P.ClH.Hg/c1-7(2,3)9-8(4,5)6;;/h9H,1-6H3;1H;/q;;+1/p-1.
What are the key properties of ditert-butylphosphane;mercury(1+);chloride?
ditert-butylphosphane;mercury(1+);chloride has a molecular weight of 382.26 g/mol, XLogP of 0.26, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butylphosphane;mercury(1+);chloride is sourced from PubChem (CID 171375109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).