C10H13ClO2 — CID 171375251
3-(2-chloroethyl)-5,6-dimethoxycyclohexa-1,2,4-triene (PubChem CID 171375251) has the molecular formula C10H13ClO2 and a molecular weight of 200.66 g/mol. Its IUPAC name is 3-(2-chloroethyl)-5,6-dimethoxycyclohexa-1,2,4-triene.
| Compound Name | 3-(2-chloroethyl)-5,6-dimethoxycyclohexa-1,2,4-triene |
|---|---|
| PubChem CID | 171375251 |
| Molecular Formula | C10H13ClO2 |
| Molecular Weight | 200.66 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 3-(2-chloroethyl)-5,6-dimethoxycyclohexa-1,2,4-triene |
| SMILES | COC1=CC(CCCl)=C=CC1OC |
| InChI | InChI=1S/C10H13ClO2/c1-12-9-4-3-8(5-6-11)7-10(9)13-2/h4,7,9H,5-6H2,1-2H3 |
| InChIKey | PMHNVSSEXPLBKD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.66 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|