About CID 171375674
CID 171375674 (PubChem CID 171375674) has the molecular formula C23H47OSn-
and a molecular weight of 458.34 g/mol.
Molecular Properties
| Compound Name | CID 171375674 |
| PubChem CID | 171375674 |
| Molecular Formula | C23H47OSn- |
| Molecular Weight | 458.34 g/mol |
| Exact Mass | 459.27 |
| IUPAC Name | — |
| SMILES | CCCC.CCCC.CCCC.[O-]CC1CC2CC1C1CCCC21.[Sn] |
| InChI | InChI=1S/C11H17O.3C4H10.Sn/c12-6-8-4-7-5-11(8)10-3-1-2-9(7)10;3*1-3-4-2;/h7-11H,1-6H2;3*3-4H2,1-2H3;/q-1;;;; |
| InChIKey | JCSUGEWBPHFGTP-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.34 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 171375674 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 171375674?
The IUPAC name of CID 171375674 (CID 171375674) is not available.
What is the SMILES notation for CID 171375674?
The canonical SMILES for CID 171375674 is CCCC.CCCC.CCCC.[O-]CC1CC2CC1C1CCCC21.[Sn].
What is the InChIKey of CID 171375674?
The InChIKey is JCSUGEWBPHFGTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17O.3C4H10.Sn/c12-6-8-4-7-5-11(8)10-3-1-2-9(7)10;3*1-3-4-2;/h7-11H,1-6H2;3*3-4H2,1-2H3;/q-1;;;;.
What are the key properties of CID 171375674?
CID 171375674 has a molecular weight of 458.34 g/mol, XLogP of 6.46, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 171375674 is sourced from PubChem (CID 171375674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).