C19H19ClN2O — CID 171375764
2,5,6,11-tetramethylpyrido[4,3-b]carbazol-2-ium-9-olate;hydrochloride (PubChem CID 171375764) has the molecular formula C19H19ClN2O and a molecular weight of 326.83 g/mol. Its IUPAC name is 2,5,6,11-tetramethylpyrido[4,3-b]carbazol-2-ium-9-olate;hydrochloride.
| Compound Name | 2,5,6,11-tetramethylpyrido[4,3-b]carbazol-2-ium-9-olate;hydrochloride |
|---|---|
| PubChem CID | 171375764 |
| Molecular Formula | C19H19ClN2O |
| Molecular Weight | 326.83 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 2,5,6,11-tetramethylpyrido[4,3-b]carbazol-2-ium-9-olate;hydrochloride |
| SMILES | Cc1c2c[n+](C)ccc2c(C)c2c1c1cc([O-])ccc1n2C.Cl |
| InChI | InChI=1S/C19H18N2O.ClH/c1-11-16-10-20(3)8-7-14(16)12(2)19-18(11)15-9-13(22)5-6-17(15)21(19)4;/h5-10H,1-4H3;1H |
| InChIKey | NWGCFJXDJRSBNA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 31.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.83 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|