About 3-(5-chloro-2-methyl-1,3-benzothiazol-3-ium-3-yl)propanoate;hydroiodide
3-(5-chloro-2-methyl-1,3-benzothiazol-3-ium-3-yl)propanoate;hydroiodide (PubChem CID 171376076) has the molecular formula C11H11ClINO2S
and a molecular weight of 383.64 g/mol. Its IUPAC name is 3-(5-chloro-2-methyl-1,3-benzothiazol-3-ium-3-yl)propanoate;hydroiodide.
Molecular Properties
| Compound Name | 3-(5-chloro-2-methyl-1,3-benzothiazol-3-ium-3-yl)propanoate;hydroiodide |
| PubChem CID | 171376076 |
| Molecular Formula | C11H11ClINO2S |
| Molecular Weight | 383.64 g/mol |
| Exact Mass | 382.92 |
| IUPAC Name | 3-(5-chloro-2-methyl-1,3-benzothiazol-3-ium-3-yl)propanoate;hydroiodide |
| SMILES | Cc1sc2ccc(Cl)cc2[n+]1CCC(=O)[O-].I |
| InChI | InChI=1S/C11H10ClNO2S.HI/c1-7-13(5-4-11(14)15)9-6-8(12)2-3-10(9)16-7;/h2-3,6H,4-5H2,1H3;1H |
| InChIKey | UWVQCNULHDOQKE-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 44.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.64 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(5-chloro-2-methyl-1,3-benzothiazol-3-ium-3-yl)propanoate;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-chloro-2-methyl-1,3-benzothiazol-3-ium-3-yl)propanoate;hydroiodide?
The IUPAC name of 3-(5-chloro-2-methyl-1,3-benzothiazol-3-ium-3-yl)propanoate;hydroiodide (CID 171376076) is 3-(5-chloro-2-methyl-1,3-benzothiazol-3-ium-3-yl)propanoate;hydroiodide.
What is the SMILES notation for 3-(5-chloro-2-methyl-1,3-benzothiazol-3-ium-3-yl)propanoate;hydroiodide?
The canonical SMILES for 3-(5-chloro-2-methyl-1,3-benzothiazol-3-ium-3-yl)propanoate;hydroiodide is Cc1sc2ccc(Cl)cc2[n+]1CCC(=O)[O-].I.
What is the InChIKey of 3-(5-chloro-2-methyl-1,3-benzothiazol-3-ium-3-yl)propanoate;hydroiodide?
The InChIKey is UWVQCNULHDOQKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10ClNO2S.HI/c1-7-13(5-4-11(14)15)9-6-8(12)2-3-10(9)16-7;/h2-3,6H,4-5H2,1H3;1H.
What are the key properties of 3-(5-chloro-2-methyl-1,3-benzothiazol-3-ium-3-yl)propanoate;hydroiodide?
3-(5-chloro-2-methyl-1,3-benzothiazol-3-ium-3-yl)propanoate;hydroiodide has a molecular weight of 383.64 g/mol, XLogP of 1.91, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-chloro-2-methyl-1,3-benzothiazol-3-ium-3-yl)propanoate;hydroiodide is sourced from PubChem (CID 171376076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).