C49H84N2NaO9PS2 — CID 171376307
sodium N-[2-[[(2R)-2,3-bis[[(Z)-octadec-9-enoyl]oxy]propoxy]-hydroxyphosphoryl]oxyethyl]-3-(pyridin-2-yldisulfanyl)propanimidate (PubChem CID 171376307) has the molecular formula C49H84N2NaO9PS2 and a molecular weight of 963.31 g/mol. Its IUPAC name is sodium N-[2-[[(2R)-2,3-bis[[(Z)-octadec-9-enoyl]oxy]propoxy]-hydroxyphosphoryl]oxyethyl]-3-(pyridin-2-yldisulfanyl)propanimidate.
| Compound Name | sodium N-[2-[[(2R)-2,3-bis[[(Z)-octadec-9-enoyl]oxy]propoxy]-hydroxyphosphoryl]oxyethyl]-3-(pyridin-2-yldisulfanyl)propanimidate |
|---|---|
| PubChem CID | 171376307 |
| Molecular Formula | C49H84N2NaO9PS2 |
| Molecular Weight | 963.31 g/mol |
| Exact Mass | 962.53 |
| IUPAC Name | sodium N-[2-[[(2R)-2,3-bis[[(Z)-octadec-9-enoyl]oxy]propoxy]-hydroxyphosphoryl]oxyethyl]-3-(pyridin-2-yldisulfanyl)propanimidate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)(O)OCC/N=C(\[O-])CCSSc1ccccn1)OC(=O)CCCCCCC/C=C\CCCCCCCC.[Na+] |
| InChI | InChI=1S/C49H85N2O9PS2.Na/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-36-48(53)57-43-45(60-49(54)37-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2)44-59-61(55,56)58-41-40-50-46(52)38-42-62-63-47-35-33-34-39-51-47;/h17-20,33-35,39,45H,3-16,21-32,36-38,40-44H2,1-2H3,(H,50,52)(H,55,56);/q;+1/p-1/b19-17-,20-18-;/t45-;/m1./s1 |
| InChIKey | LFMWVVNPVNIPJG-JQRYTBKHSA-M |
| XLogP | 10.64 |
| TPSA | 156.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 963.31 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|