C15H17N5O3S — CID 171376450
N-[(E)-(1-butan-2-yl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]pyridine-4-carbohydrazide (PubChem CID 171376450) has the molecular formula C15H17N5O3S and a molecular weight of 347.40 g/mol. Its IUPAC name is N-[(E)-(1-butan-2-yl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]pyridine-4-carbohydrazide.
| Compound Name | N-[(E)-(1-butan-2-yl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 171376450 |
| Molecular Formula | C15H17N5O3S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | N-[(E)-(1-butan-2-yl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]pyridine-4-carbohydrazide |
| SMILES | CCC(C)N1C(=O)/C(=C/N(N)C(=O)c2ccncc2)C(=O)NC1=S |
| InChI | InChI=1S/C15H17N5O3S/c1-3-9(2)20-14(23)11(12(21)18-15(20)24)8-19(16)13(22)10-4-6-17-7-5-10/h4-9H,3,16H2,1-2H3,(H,18,21,24)/b11-8+ |
| InChIKey | WBJYDMHYOSEXHX-DHZHZOJOSA-N |
| XLogP | 0.32 |
| TPSA | 108.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|