About palladium(2+);2-(2-piperidin-1-id-2-ylethyl)piperidin-1-ide;dichloride
palladium(2+);2-(2-piperidin-1-id-2-ylethyl)piperidin-1-ide;dichloride (PubChem CID 171376800) has the molecular formula C12H22Cl2N2Pd-2
and a molecular weight of 371.65 g/mol. Its IUPAC name is palladium(2+);2-(2-piperidin-1-id-2-ylethyl)piperidin-1-ide;dichloride.
Molecular Properties
| Compound Name | palladium(2+);2-(2-piperidin-1-id-2-ylethyl)piperidin-1-ide;dichloride |
| PubChem CID | 171376800 |
| Molecular Formula | C12H22Cl2N2Pd-2 |
| Molecular Weight | 371.65 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | palladium(2+);2-(2-piperidin-1-id-2-ylethyl)piperidin-1-ide;dichloride |
| SMILES | C1CCC(CCC2CCCC[N-]2)[N-]C1.[Cl-].[Cl-].[Pd+2] |
| InChI | InChI=1S/C12H22N2.2ClH.Pd/c1-3-9-13-11(5-1)7-8-12-6-2-4-10-14-12;;;/h11-12H,1-10H2;2*1H;/q-2;;;+2/p-2 |
| InChIKey | HDXBIBHCVIOLAL-UHFFFAOYSA-L |
| XLogP | -2.38 |
| TPSA | 28.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.65 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze palladium(2+);2-(2-piperidin-1-id-2-ylethyl)piperidin-1-ide;dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of palladium(2+);2-(2-piperidin-1-id-2-ylethyl)piperidin-1-ide;dichloride?
The IUPAC name of palladium(2+);2-(2-piperidin-1-id-2-ylethyl)piperidin-1-ide;dichloride (CID 171376800) is palladium(2+);2-(2-piperidin-1-id-2-ylethyl)piperidin-1-ide;dichloride.
What is the SMILES notation for palladium(2+);2-(2-piperidin-1-id-2-ylethyl)piperidin-1-ide;dichloride?
The canonical SMILES for palladium(2+);2-(2-piperidin-1-id-2-ylethyl)piperidin-1-ide;dichloride is C1CCC(CCC2CCCC[N-]2)[N-]C1.[Cl-].[Cl-].[Pd+2].
What is the InChIKey of palladium(2+);2-(2-piperidin-1-id-2-ylethyl)piperidin-1-ide;dichloride?
The InChIKey is HDXBIBHCVIOLAL-UHFFFAOYSA-L. The full InChI is InChI=1S/C12H22N2.2ClH.Pd/c1-3-9-13-11(5-1)7-8-12-6-2-4-10-14-12;;;/h11-12H,1-10H2;2*1H;/q-2;;;+2/p-2.
What are the key properties of palladium(2+);2-(2-piperidin-1-id-2-ylethyl)piperidin-1-ide;dichloride?
palladium(2+);2-(2-piperidin-1-id-2-ylethyl)piperidin-1-ide;dichloride has a molecular weight of 371.65 g/mol, XLogP of -2.38, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for palladium(2+);2-(2-piperidin-1-id-2-ylethyl)piperidin-1-ide;dichloride is sourced from PubChem (CID 171376800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).