C12H14 — CID 171377918
(4E)-bicyclo[6.3.1]dodeca-1(12),4,8,10-tetraene (PubChem CID 171377918) has the molecular formula C12H14 and a molecular weight of 158.24 g/mol. Its IUPAC name is (4E)-bicyclo[6.3.1]dodeca-1(12),4,8,10-tetraene.
| Compound Name | (4E)-bicyclo[6.3.1]dodeca-1(12),4,8,10-tetraene |
|---|---|
| PubChem CID | 171377918 |
| Molecular Formula | C12H14 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | (4E)-bicyclo[6.3.1]dodeca-1(12),4,8,10-tetraene |
| SMILES | C1=C\CCc2cccc(c2)CC/1 |
| InChI | InChI=1S/C12H14/c1-2-4-7-12-9-5-8-11(10-12)6-3-1/h1-2,5,8-10H,3-4,6-7H2/b2-1- |
| InChIKey | LBNLKEHUWUONHA-UPHRSURJSA-N |
| XLogP | 3.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|