About thiadiazolo[5,4-d]pyrimidine-5-carbonitrile
thiadiazolo[5,4-d]pyrimidine-5-carbonitrile (PubChem CID 171378023) has the molecular formula C5HN5S
and a molecular weight of 163.16 g/mol. Its IUPAC name is thiadiazolo[5,4-d]pyrimidine-5-carbonitrile.
Molecular Properties
| Compound Name | thiadiazolo[5,4-d]pyrimidine-5-carbonitrile |
| PubChem CID | 171378023 |
| Molecular Formula | C5HN5S |
| Molecular Weight | 163.16 g/mol |
| Exact Mass | 163.00 |
| IUPAC Name | thiadiazolo[5,4-d]pyrimidine-5-carbonitrile |
| SMILES | N#Cc1ncc2nnsc2n1 |
| InChI | InChI=1S/C5HN5S/c6-1-4-7-2-3-5(8-4)11-10-9-3/h2H |
| InChIKey | PCVCNHPUPYKHIC-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 75.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.16 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze thiadiazolo[5,4-d]pyrimidine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiadiazolo[5,4-d]pyrimidine-5-carbonitrile?
The IUPAC name of thiadiazolo[5,4-d]pyrimidine-5-carbonitrile (CID 171378023) is thiadiazolo[5,4-d]pyrimidine-5-carbonitrile.
What is the SMILES notation for thiadiazolo[5,4-d]pyrimidine-5-carbonitrile?
The canonical SMILES for thiadiazolo[5,4-d]pyrimidine-5-carbonitrile is N#Cc1ncc2nnsc2n1.
What is the InChIKey of thiadiazolo[5,4-d]pyrimidine-5-carbonitrile?
The InChIKey is PCVCNHPUPYKHIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5HN5S/c6-1-4-7-2-3-5(8-4)11-10-9-3/h2H.
What are the key properties of thiadiazolo[5,4-d]pyrimidine-5-carbonitrile?
thiadiazolo[5,4-d]pyrimidine-5-carbonitrile has a molecular weight of 163.16 g/mol, XLogP of 0.35, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for thiadiazolo[5,4-d]pyrimidine-5-carbonitrile is sourced from PubChem (CID 171378023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).