About [3-acetyloxy-2-(3,4-diethoxyphenyl)-1-benzofuran-6-yl] acetate
[3-acetyloxy-2-(3,4-diethoxyphenyl)-1-benzofuran-6-yl] acetate (PubChem CID 171378437) has the molecular formula C22H22O7
and a molecular weight of 398.41 g/mol. Its IUPAC name is [3-acetyloxy-2-(3,4-diethoxyphenyl)-1-benzofuran-6-yl] acetate.
Molecular Properties
| Compound Name | [3-acetyloxy-2-(3,4-diethoxyphenyl)-1-benzofuran-6-yl] acetate |
| PubChem CID | 171378437 |
| Molecular Formula | C22H22O7 |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | [3-acetyloxy-2-(3,4-diethoxyphenyl)-1-benzofuran-6-yl] acetate |
| SMILES | CCOc1ccc(-c2oc3cc(OC(C)=O)ccc3c2OC(C)=O)cc1OCC |
| InChI | InChI=1S/C22H22O7/c1-5-25-18-10-7-15(11-20(18)26-6-2)21-22(28-14(4)24)17-9-8-16(27-13(3)23)12-19(17)29-21/h7-12H,5-6H2,1-4H3 |
| InChIKey | SNQXHBPVFFCPOR-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-acetyloxy-2-(3,4-diethoxyphenyl)-1-benzofuran-6-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-acetyloxy-2-(3,4-diethoxyphenyl)-1-benzofuran-6-yl] acetate?
The IUPAC name of [3-acetyloxy-2-(3,4-diethoxyphenyl)-1-benzofuran-6-yl] acetate (CID 171378437) is [3-acetyloxy-2-(3,4-diethoxyphenyl)-1-benzofuran-6-yl] acetate.
What is the SMILES notation for [3-acetyloxy-2-(3,4-diethoxyphenyl)-1-benzofuran-6-yl] acetate?
The canonical SMILES for [3-acetyloxy-2-(3,4-diethoxyphenyl)-1-benzofuran-6-yl] acetate is CCOc1ccc(-c2oc3cc(OC(C)=O)ccc3c2OC(C)=O)cc1OCC.
What is the InChIKey of [3-acetyloxy-2-(3,4-diethoxyphenyl)-1-benzofuran-6-yl] acetate?
The InChIKey is SNQXHBPVFFCPOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22O7/c1-5-25-18-10-7-15(11-20(18)26-6-2)21-22(28-14(4)24)17-9-8-16(27-13(3)23)12-19(17)29-21/h7-12H,5-6H2,1-4H3.
What are the key properties of [3-acetyloxy-2-(3,4-diethoxyphenyl)-1-benzofuran-6-yl] acetate?
[3-acetyloxy-2-(3,4-diethoxyphenyl)-1-benzofuran-6-yl] acetate has a molecular weight of 398.41 g/mol, XLogP of 4.75, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-acetyloxy-2-(3,4-diethoxyphenyl)-1-benzofuran-6-yl] acetate is sourced from PubChem (CID 171378437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).