C8H12N2O2 — CID 171379013
1,1,2,2,3,3,4,4,5,5,6,6-dodecadeuterio-1,6-diisocyanatohexane (PubChem CID 171379013) has the molecular formula C8H12N2O2 and a molecular weight of 180.27 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6-dodecadeuterio-1,6-diisocyanatohexane.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6-dodecadeuterio-1,6-diisocyanatohexane |
|---|---|
| PubChem CID | 171379013 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 180.27 g/mol |
| Exact Mass | 180.17 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6-dodecadeuterio-1,6-diisocyanatohexane |
| SMILES | [2H]C([2H])(N=C=O)C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])N=C=O |
| InChI | InChI=1S/C8H12N2O2/c11-7-9-5-3-1-2-4-6-10-8-12/h1-6H2/i1D2,2D2,3D2,4D2,5D2,6D2 |
| InChIKey | RRAMGCGOFNQTLD-LBTWDOQPSA-N |
| XLogP | 1.22 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.27 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|