C21H24ClN3O5S — CID 171379105
7-[(3-chloro-6-methyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-yl)-nitrosoamino]heptanoic acid (PubChem CID 171379105) has the molecular formula C21H24ClN3O5S and a molecular weight of 465.96 g/mol. Its IUPAC name is 7-[(3-chloro-6-methyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-yl)-nitrosoamino]heptanoic acid.
| Compound Name | 7-[(3-chloro-6-methyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-yl)-nitrosoamino]heptanoic acid |
|---|---|
| PubChem CID | 171379105 |
| Molecular Formula | C21H24ClN3O5S |
| Molecular Weight | 465.96 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | 7-[(3-chloro-6-methyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-yl)-nitrosoamino]heptanoic acid |
| SMILES | CN1c2ccccc2C(N(CCCCCCC(=O)O)N=O)c2ccc(Cl)cc2S1(=O)=O |
| InChI | InChI=1S/C21H24ClN3O5S/c1-24-18-9-6-5-8-16(18)21(17-12-11-15(22)14-19(17)31(24,29)30)25(23-28)13-7-3-2-4-10-20(26)27/h5-6,8-9,11-12,14,21H,2-4,7,10,13H2,1H3,(H,26,27) |
| InChIKey | TZKIDOHRUQKRCX-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 107.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.96 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|