About 6-chloro-3-hydroxy-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-2-one
6-chloro-3-hydroxy-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-2-one (PubChem CID 171379209) has the molecular formula C10H8ClN3O2
and a molecular weight of 237.65 g/mol. Its IUPAC name is 6-chloro-3-hydroxy-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-2-one.
Molecular Properties
| Compound Name | 6-chloro-3-hydroxy-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-2-one |
| PubChem CID | 171379209 |
| Molecular Formula | C10H8ClN3O2 |
| Molecular Weight | 237.65 g/mol |
| Exact Mass | 237.03 |
| IUPAC Name | 6-chloro-3-hydroxy-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-2-one |
| SMILES | O=C1NC2=Nc3cccc(Cl)c3CN2C1O |
| InChI | InChI=1S/C10H8ClN3O2/c11-6-2-1-3-7-5(6)4-14-9(16)8(15)13-10(14)12-7/h1-3,9,16H,4H2,(H,12,13,15) |
| InChIKey | MEGLPWLNKQYDMW-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.65 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-chloro-3-hydroxy-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3-hydroxy-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-2-one?
The IUPAC name of 6-chloro-3-hydroxy-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-2-one (CID 171379209) is 6-chloro-3-hydroxy-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-2-one.
What is the SMILES notation for 6-chloro-3-hydroxy-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-2-one?
The canonical SMILES for 6-chloro-3-hydroxy-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-2-one is O=C1NC2=Nc3cccc(Cl)c3CN2C1O.
What is the InChIKey of 6-chloro-3-hydroxy-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-2-one?
The InChIKey is MEGLPWLNKQYDMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8ClN3O2/c11-6-2-1-3-7-5(6)4-14-9(16)8(15)13-10(14)12-7/h1-3,9,16H,4H2,(H,12,13,15).
What are the key properties of 6-chloro-3-hydroxy-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-2-one?
6-chloro-3-hydroxy-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-2-one has a molecular weight of 237.65 g/mol, XLogP of 0.59, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3-hydroxy-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-2-one is sourced from PubChem (CID 171379209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).