C15H15N — CID 171379636
(5S)-1-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)-3-azabicyclo[3.1.0]hexane (PubChem CID 171379636) has the molecular formula C15H15N and a molecular weight of 216.33 g/mol. Its IUPAC name is (5S)-1-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)-3-azabicyclo[3.1.0]hexane.
| Compound Name | (5S)-1-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 171379636 |
| Molecular Formula | C15H15N |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | (5S)-1-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)-3-azabicyclo[3.1.0]hexane |
| SMILES | [2H]c1c([2H])c([2H])c2c([2H])c(C34CNC[C@H]3C4)c([2H])c([2H])c2c1[2H] |
| InChI | InChI=1S/C15H15N/c1-2-4-12-7-13(6-5-11(12)3-1)15-8-14(15)9-16-10-15/h1-7,14,16H,8-10H2/t14-,15?/m1/s1/i1D,2D,3D,4D,5D,6D,7D |
| InChIKey | HKHCSWPSUSWGLI-FDGPQVJDSA-N |
| XLogP | 2.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |