C8H10O5 — CID 171379864
(4S,7S)-7-hydroxy-4-methoxy-4,6,7,7a-tetrahydro(4,5-13C2)furano[3,2-c](213C)pyran-2-one (PubChem CID 171379864) has the molecular formula C8H10O5 and a molecular weight of 189.14 g/mol. Its IUPAC name is (4S,7S)-7-hydroxy-4-methoxy-4,6,7,7a-tetrahydro(4,5-13C2)furano[3,2-c](213C)pyran-2-one.
| Compound Name | (4S,7S)-7-hydroxy-4-methoxy-4,6,7,7a-tetrahydro(4,5-13C2)furano[3,2-c](213C)pyran-2-one |
|---|---|
| PubChem CID | 171379864 |
| Molecular Formula | C8H10O5 |
| Molecular Weight | 189.14 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | (4S,7S)-7-hydroxy-4-methoxy-4,6,7,7a-tetrahydro(4,5-13C2)furano[3,2-c](213C)pyran-2-one |
| SMILES | CO[13C@H]1OC[C@H](O)C2O[13C](=O)[13CH]=C21 |
| InChI | InChI=1S/C8H10O5/c1-11-8-4-2-6(10)13-7(4)5(9)3-12-8/h2,5,7-9H,3H2,1H3/t5-,7?,8-/m0/s1/i2+1,6+1,8+1 |
| InChIKey | VFVYCHOMLNCURP-SXZSISPLSA-N |
| XLogP | -0.80 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.14 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |