C15H24NO5P — CID 171380461
propan-2-yl 2-[ethoxy-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)phosphoryl]oxybenzoate (PubChem CID 171380461) has the molecular formula C15H24NO5P and a molecular weight of 336.38 g/mol. Its IUPAC name is propan-2-yl 2-[ethoxy-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)phosphoryl]oxybenzoate.
| Compound Name | propan-2-yl 2-[ethoxy-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)phosphoryl]oxybenzoate |
|---|---|
| PubChem CID | 171380461 |
| Molecular Formula | C15H24NO5P |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | propan-2-yl 2-[ethoxy-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)phosphoryl]oxybenzoate |
| SMILES | [2H]C([2H])([2H])C([2H])(NP(=O)(OCC)Oc1ccccc1C(=O)OC(C)C)C([2H])([2H])[2H] |
| InChI | InChI=1S/C15H24NO5P/c1-6-19-22(18,16-11(2)3)21-14-10-8-7-9-13(14)15(17)20-12(4)5/h7-12H,6H2,1-5H3,(H,16,18)/i2D3,3D3,11D |
| InChIKey | DZUPKTNAUCDVTL-KDUSNLSVSA-N |
| XLogP | 3.77 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|