C13H19NO6 — CID 171380777
[2-[(2R)-2-aminopropoxy]-3-methylphenyl]methanol;oxalic acid (PubChem CID 171380777) has the molecular formula C13H19NO6 and a molecular weight of 285.30 g/mol. Its IUPAC name is [2-[(2R)-2-aminopropoxy]-3-methylphenyl]methanol;oxalic acid.
| Compound Name | [2-[(2R)-2-aminopropoxy]-3-methylphenyl]methanol;oxalic acid |
|---|---|
| PubChem CID | 171380777 |
| Molecular Formula | C13H19NO6 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | [2-[(2R)-2-aminopropoxy]-3-methylphenyl]methanol;oxalic acid |
| SMILES | Cc1cccc(CO)c1OC[C@@H](C)N.O=C(O)C(=O)O |
| InChI | InChI=1S/C11H17NO2.C2H2O4/c1-8-4-3-5-10(6-13)11(8)14-7-9(2)12;3-1(4)2(5)6/h3-5,9,13H,6-7,12H2,1-2H3;(H,3,4)(H,5,6)/t9-;/m1./s1 |
| InChIKey | VZVOJJXBPMAFQG-SBSPUUFOSA-N |
| XLogP | 0.37 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|