C6H9NO2 — CID 171380787
(3aR,6aR)-5,5-dideuterio-3a,4,6,6a-tetrahydro-3H-furo[3,2-b]pyrrol-2-one (PubChem CID 171380787) has the molecular formula C6H9NO2 and a molecular weight of 129.16 g/mol. Its IUPAC name is (3aR,6aR)-5,5-dideuterio-3a,4,6,6a-tetrahydro-3H-furo[3,2-b]pyrrol-2-one.
| Compound Name | (3aR,6aR)-5,5-dideuterio-3a,4,6,6a-tetrahydro-3H-furo[3,2-b]pyrrol-2-one |
|---|---|
| PubChem CID | 171380787 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | (3aR,6aR)-5,5-dideuterio-3a,4,6,6a-tetrahydro-3H-furo[3,2-b]pyrrol-2-one |
| SMILES | [2H]C1([2H])C[C@H]2OC(=O)C[C@H]2N1 |
| InChI | InChI=1S/C6H9NO2/c8-6-3-4-5(9-6)1-2-7-4/h4-5,7H,1-3H2/t4-,5-/m1/s1/i2D2 |
| InChIKey | TZRVFSMXGZGULU-RMMLTXHJSA-N |
| XLogP | -0.34 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |