C17H15O7+ — CID 171381547
2-[4-hydroxy-3,5-bis(trideuteriomethoxy)phenyl]chromenylium-3,5,7-triol (PubChem CID 171381547) has the molecular formula C17H15O7+ and a molecular weight of 337.34 g/mol. Its IUPAC name is 2-[4-hydroxy-3,5-bis(trideuteriomethoxy)phenyl]chromenylium-3,5,7-triol.
| Compound Name | 2-[4-hydroxy-3,5-bis(trideuteriomethoxy)phenyl]chromenylium-3,5,7-triol |
|---|---|
| PubChem CID | 171381547 |
| Molecular Formula | C17H15O7+ |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 2-[4-hydroxy-3,5-bis(trideuteriomethoxy)phenyl]chromenylium-3,5,7-triol |
| SMILES | [2H]C([2H])([2H])Oc1cc(-c2[o+]c3cc(O)cc(O)c3cc2O)cc(OC([2H])([2H])[2H])c1O |
| InChI | InChI=1S/C17H14O7/c1-22-14-3-8(4-15(23-2)16(14)21)17-12(20)7-10-11(19)5-9(18)6-13(10)24-17/h3-7H,1-2H3,(H3-,18,19,20,21)/p+1/i1D3,2D3 |
| InChIKey | KZMACGJDUUWFCH-WFGJKAKNSA-O |
| XLogP | 3.22 |
| TPSA | 110.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|