C9H22ClN2O4P — CID 171382290
3-[2-[(2-chloro-1,1,2,2-tetradeuterioethyl)amino]ethylamino]propyl ethyl hydrogen phosphate (PubChem CID 171382290) has the molecular formula C9H22ClN2O4P and a molecular weight of 292.74 g/mol. Its IUPAC name is 3-[2-[(2-chloro-1,1,2,2-tetradeuterioethyl)amino]ethylamino]propyl ethyl hydrogen phosphate.
| Compound Name | 3-[2-[(2-chloro-1,1,2,2-tetradeuterioethyl)amino]ethylamino]propyl ethyl hydrogen phosphate |
|---|---|
| PubChem CID | 171382290 |
| Molecular Formula | C9H22ClN2O4P |
| Molecular Weight | 292.74 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 3-[2-[(2-chloro-1,1,2,2-tetradeuterioethyl)amino]ethylamino]propyl ethyl hydrogen phosphate |
| SMILES | [2H]C([2H])(Cl)C([2H])([2H])NCCNCCCOP(=O)(O)OCC |
| InChI | InChI=1S/C9H22ClN2O4P/c1-2-15-17(13,14)16-9-3-5-11-7-8-12-6-4-10/h11-12H,2-9H2,1H3,(H,13,14)/i4D2,6D2 |
| InChIKey | OTKUTBQHOKHMBL-WVTKESLNSA-N |
| XLogP | 0.95 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.74 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|