About N-[(4-chloro-2-pyridinyl)methyl]-1,1,1-trideuteriomethanamine
N-[(4-chloro-2-pyridinyl)methyl]-1,1,1-trideuteriomethanamine (PubChem CID 171382347) has the molecular formula C7H9ClN2
and a molecular weight of 159.63 g/mol. Its IUPAC name is N-[(4-chloro-2-pyridinyl)methyl]-1,1,1-trideuteriomethanamine.
Molecular Properties
| Compound Name | N-[(4-chloro-2-pyridinyl)methyl]-1,1,1-trideuteriomethanamine |
| PubChem CID | 171382347 |
| Molecular Formula | C7H9ClN2 |
| Molecular Weight | 159.63 g/mol |
| Exact Mass | 159.06 |
| IUPAC Name | N-[(4-chloro-2-pyridinyl)methyl]-1,1,1-trideuteriomethanamine |
| SMILES | [2H]C([2H])([2H])NCc1cc(Cl)ccn1 |
| InChI | InChI=1S/C7H9ClN2/c1-9-5-7-4-6(8)2-3-10-7/h2-4,9H,5H2,1H3/i1D3 |
| InChIKey | IJVFBZXCXLCBFD-FIBGUPNXSA-N |
| XLogP | 1.45 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.63 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(4-chloro-2-pyridinyl)methyl]-1,1,1-trideuteriomethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-chloro-2-pyridinyl)methyl]-1,1,1-trideuteriomethanamine?
The IUPAC name of N-[(4-chloro-2-pyridinyl)methyl]-1,1,1-trideuteriomethanamine (CID 171382347) is N-[(4-chloro-2-pyridinyl)methyl]-1,1,1-trideuteriomethanamine.
What is the SMILES notation for N-[(4-chloro-2-pyridinyl)methyl]-1,1,1-trideuteriomethanamine?
The canonical SMILES for N-[(4-chloro-2-pyridinyl)methyl]-1,1,1-trideuteriomethanamine is [2H]C([2H])([2H])NCc1cc(Cl)ccn1.
What is the InChIKey of N-[(4-chloro-2-pyridinyl)methyl]-1,1,1-trideuteriomethanamine?
The InChIKey is IJVFBZXCXLCBFD-FIBGUPNXSA-N. The full InChI is InChI=1S/C7H9ClN2/c1-9-5-7-4-6(8)2-3-10-7/h2-4,9H,5H2,1H3/i1D3.
What are the key properties of N-[(4-chloro-2-pyridinyl)methyl]-1,1,1-trideuteriomethanamine?
N-[(4-chloro-2-pyridinyl)methyl]-1,1,1-trideuteriomethanamine has a molecular weight of 159.63 g/mol, XLogP of 1.45, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-chloro-2-pyridinyl)methyl]-1,1,1-trideuteriomethanamine is sourced from PubChem (CID 171382347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).