C11H19N2O3+ — CID 171382596
2-amino-3-(2,2,5,5-tetramethyl-1-oxopyrrol-1-ium-3-yl)propanoic acid (PubChem CID 171382596) has the molecular formula C11H19N2O3+ and a molecular weight of 227.28 g/mol. Its IUPAC name is 2-amino-3-(2,2,5,5-tetramethyl-1-oxopyrrol-1-ium-3-yl)propanoic acid.
| Compound Name | 2-amino-3-(2,2,5,5-tetramethyl-1-oxopyrrol-1-ium-3-yl)propanoic acid |
|---|---|
| PubChem CID | 171382596 |
| Molecular Formula | C11H19N2O3+ |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 2-amino-3-(2,2,5,5-tetramethyl-1-oxopyrrol-1-ium-3-yl)propanoic acid |
| SMILES | CC1(C)C=C(CC(N)C(=O)O)C(C)(C)[N+]1=O |
| InChI | InChI=1S/C11H18N2O3/c1-10(2)6-7(5-8(12)9(14)15)11(3,4)13(10)16/h6,8H,5,12H2,1-4H3/p+1 |
| InChIKey | ZSZQIALMMUDESL-UHFFFAOYSA-O |
| XLogP | 1.06 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|