C30H33F2N7O4 — CID 171382621
6-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-2-N,4-N-bis(prop-2-enyl)-1,3,5-triazine-2,4-diamine;(Z)-but-2-enedioic acid (PubChem CID 171382621) has the molecular formula C30H33F2N7O4 and a molecular weight of 593.64 g/mol. Its IUPAC name is 6-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-2-N,4-N-bis(prop-2-enyl)-1,3,5-triazine-2,4-diamine;(Z)-but-2-enedioic acid.
| Compound Name | 6-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-2-N,4-N-bis(prop-2-enyl)-1,3,5-triazine-2,4-diamine;(Z)-but-2-enedioic acid |
|---|---|
| PubChem CID | 171382621 |
| Molecular Formula | C30H33F2N7O4 |
| Molecular Weight | 593.64 g/mol |
| Exact Mass | 593.26 |
| IUPAC Name | 6-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-2-N,4-N-bis(prop-2-enyl)-1,3,5-triazine-2,4-diamine;(Z)-but-2-enedioic acid |
| SMILES | C=CCNc1nc(NCC=C)nc(N2CCN(C(c3ccc(F)cc3)c3ccc(F)cc3)CC2)n1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C26H29F2N7.C4H4O4/c1-3-13-29-24-31-25(30-14-4-2)33-26(32-24)35-17-15-34(16-18-35)23(19-5-9-21(27)10-6-19)20-7-11-22(28)12-8-20;5-3(6)1-2-4(7)8/h3-12,23H,1-2,13-18H2,(H2,29,30,31,32,33);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | PNBVWZSEJPKMCA-BTJKTKAUSA-N |
| XLogP | 3.97 |
| TPSA | 143.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.64 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|