C27H47NO5S — CID 171382625
[(3S,5S,8R,9S,10S,13S,14S)-17-acetyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] sulfate;triethylazanium (PubChem CID 171382625) has the molecular formula C27H47NO5S and a molecular weight of 497.74 g/mol. Its IUPAC name is [(3S,5S,8R,9S,10S,13S,14S)-17-acetyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] sulfate;triethylazanium.
| Compound Name | [(3S,5S,8R,9S,10S,13S,14S)-17-acetyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] sulfate;triethylazanium |
|---|---|
| PubChem CID | 171382625 |
| Molecular Formula | C27H47NO5S |
| Molecular Weight | 497.74 g/mol |
| Exact Mass | 497.32 |
| IUPAC Name | [(3S,5S,8R,9S,10S,13S,14S)-17-acetyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] sulfate;triethylazanium |
| SMILES | CC(=O)C1=CC[C@H]2[C@@H]3CC[C@H]4C[C@@H](OS(=O)(=O)[O-])CC[C@]4(C)[C@H]3CC[C@]12C.CC[NH+](CC)CC |
| InChI | InChI=1S/C21H32O5S.C6H15N/c1-13(22)17-6-7-18-16-5-4-14-12-15(26-27(23,24)25)8-10-20(14,2)19(16)9-11-21(17,18)3;1-4-7(5-2)6-3/h6,14-16,18-19H,4-5,7-12H2,1-3H3,(H,23,24,25);4-6H2,1-3H3/t14-,15-,16-,18-,19-,20-,21+;/m0./s1 |
| InChIKey | GPVSCQZCGZYKGN-QBNFVAOYSA-N |
| XLogP | 3.93 |
| TPSA | 87.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.74 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|