C20H8F6O2S — CID 171383098
2,3-bis(3,4,5-trifluorophenyl)-1-benzothiophene 1,1-dioxide (PubChem CID 171383098) has the molecular formula C20H8F6O2S and a molecular weight of 426.34 g/mol. Its IUPAC name is 2,3-bis(3,4,5-trifluorophenyl)-1-benzothiophene 1,1-dioxide.
| Compound Name | 2,3-bis(3,4,5-trifluorophenyl)-1-benzothiophene 1,1-dioxide |
|---|---|
| PubChem CID | 171383098 |
| Molecular Formula | C20H8F6O2S |
| Molecular Weight | 426.34 g/mol |
| Exact Mass | 426.01 |
| IUPAC Name | 2,3-bis(3,4,5-trifluorophenyl)-1-benzothiophene 1,1-dioxide |
| SMILES | O=S1(=O)C(c2cc(F)c(F)c(F)c2)=C(c2cc(F)c(F)c(F)c2)c2ccccc21 |
| InChI | InChI=1S/C20H8F6O2S/c21-12-5-9(6-13(22)18(12)25)17-11-3-1-2-4-16(11)29(27,28)20(17)10-7-14(23)19(26)15(24)8-10/h1-8H |
| InChIKey | GAKKSFQCWLGOBF-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.34 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|