About spiro[2H-1-benzothiophene-3,3'-pyrrole]
spiro[2H-1-benzothiophene-3,3'-pyrrole] (PubChem CID 171383568) has the molecular formula C11H9NS
and a molecular weight of 187.27 g/mol. Its IUPAC name is spiro[2H-1-benzothiophene-3,3'-pyrrole].
Molecular Properties
| Compound Name | spiro[2H-1-benzothiophene-3,3'-pyrrole] |
| PubChem CID | 171383568 |
| Molecular Formula | C11H9NS |
| Molecular Weight | 187.27 g/mol |
| Exact Mass | 187.05 |
| IUPAC Name | spiro[2H-1-benzothiophene-3,3'-pyrrole] |
| SMILES | C1=CC2(C=N1)CSc1ccccc12 |
| InChI | InChI=1S/C11H9NS/c1-2-4-10-9(3-1)11(8-13-10)5-6-12-7-11/h1-7H,8H2 |
| InChIKey | ICVRXQGZOFQBCX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.27 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[2H-1-benzothiophene-3,3'-pyrrole] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[2H-1-benzothiophene-3,3'-pyrrole]?
The IUPAC name of spiro[2H-1-benzothiophene-3,3'-pyrrole] (CID 171383568) is spiro[2H-1-benzothiophene-3,3'-pyrrole].
What is the SMILES notation for spiro[2H-1-benzothiophene-3,3'-pyrrole]?
The canonical SMILES for spiro[2H-1-benzothiophene-3,3'-pyrrole] is C1=CC2(C=N1)CSc1ccccc12.
What is the InChIKey of spiro[2H-1-benzothiophene-3,3'-pyrrole]?
The InChIKey is ICVRXQGZOFQBCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NS/c1-2-4-10-9(3-1)11(8-13-10)5-6-12-7-11/h1-7H,8H2.
What are the key properties of spiro[2H-1-benzothiophene-3,3'-pyrrole]?
spiro[2H-1-benzothiophene-3,3'-pyrrole] has a molecular weight of 187.27 g/mol, XLogP of 2.63, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[2H-1-benzothiophene-3,3'-pyrrole] is sourced from PubChem (CID 171383568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).