C18H14ClN7 — CID 171383719
6-chloro-N-[(E)-6,7-dihydro-5H-quinolin-8-ylideneamino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine (PubChem CID 171383719) has the molecular formula C18H14ClN7 and a molecular weight of 363.81 g/mol. Its IUPAC name is 6-chloro-N-[(E)-6,7-dihydro-5H-quinolin-8-ylideneamino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine.
| Compound Name | 6-chloro-N-[(E)-6,7-dihydro-5H-quinolin-8-ylideneamino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine |
|---|---|
| PubChem CID | 171383719 |
| Molecular Formula | C18H14ClN7 |
| Molecular Weight | 363.81 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 6-chloro-N-[(E)-6,7-dihydro-5H-quinolin-8-ylideneamino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine |
| SMILES | Clc1cccc2c1[nH]c1nc(N/N=C3\CCCc4cccnc43)nnc12 |
| InChI | InChI=1S/C18H14ClN7/c19-12-7-2-6-11-15(12)21-17-16(11)24-26-18(22-17)25-23-13-8-1-4-10-5-3-9-20-14(10)13/h2-3,5-7,9H,1,4,8H2,(H2,21,22,25,26)/b23-13+ |
| InChIKey | FRVMPVDMWQFXCC-YDZHTSKRSA-N |
| XLogP | 3.71 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.81 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|