About 8-chloro-10H-pyrimido[5,4-b][1,4]benzothiazine
8-chloro-10H-pyrimido[5,4-b][1,4]benzothiazine (PubChem CID 171384015) has the molecular formula C10H6ClN3S
and a molecular weight of 235.70 g/mol. Its IUPAC name is 8-chloro-10H-pyrimido[5,4-b][1,4]benzothiazine.
Molecular Properties
| Compound Name | 8-chloro-10H-pyrimido[5,4-b][1,4]benzothiazine |
| PubChem CID | 171384015 |
| Molecular Formula | C10H6ClN3S |
| Molecular Weight | 235.70 g/mol |
| Exact Mass | 235.00 |
| IUPAC Name | 8-chloro-10H-pyrimido[5,4-b][1,4]benzothiazine |
| SMILES | Clc1ccc2c(c1)Nc1ncncc1S2 |
| InChI | InChI=1S/C10H6ClN3S/c11-6-1-2-8-7(3-6)14-10-9(15-8)4-12-5-13-10/h1-5H,(H,12,13,14) |
| InChIKey | IYWFTMLAERSGIZ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.70 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-chloro-10H-pyrimido[5,4-b][1,4]benzothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-10H-pyrimido[5,4-b][1,4]benzothiazine?
The IUPAC name of 8-chloro-10H-pyrimido[5,4-b][1,4]benzothiazine (CID 171384015) is 8-chloro-10H-pyrimido[5,4-b][1,4]benzothiazine.
What is the SMILES notation for 8-chloro-10H-pyrimido[5,4-b][1,4]benzothiazine?
The canonical SMILES for 8-chloro-10H-pyrimido[5,4-b][1,4]benzothiazine is Clc1ccc2c(c1)Nc1ncncc1S2.
What is the InChIKey of 8-chloro-10H-pyrimido[5,4-b][1,4]benzothiazine?
The InChIKey is IYWFTMLAERSGIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6ClN3S/c11-6-1-2-8-7(3-6)14-10-9(15-8)4-12-5-13-10/h1-5H,(H,12,13,14).
What are the key properties of 8-chloro-10H-pyrimido[5,4-b][1,4]benzothiazine?
8-chloro-10H-pyrimido[5,4-b][1,4]benzothiazine has a molecular weight of 235.70 g/mol, XLogP of 3.34, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-10H-pyrimido[5,4-b][1,4]benzothiazine is sourced from PubChem (CID 171384015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).