C9H16N6O4 — CID 171384056
N-(2,2-dinitropropyl)-3,5-diethyl-1,2,4-triazol-4-amine (PubChem CID 171384056) has the molecular formula C9H16N6O4 and a molecular weight of 272.26 g/mol. Its IUPAC name is N-(2,2-dinitropropyl)-3,5-diethyl-1,2,4-triazol-4-amine.
| Compound Name | N-(2,2-dinitropropyl)-3,5-diethyl-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 171384056 |
| Molecular Formula | C9H16N6O4 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | N-(2,2-dinitropropyl)-3,5-diethyl-1,2,4-triazol-4-amine |
| SMILES | CCc1nnc(CC)n1NCC(C)([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C9H16N6O4/c1-4-7-11-12-8(5-2)13(7)10-6-9(3,14(16)17)15(18)19/h10H,4-6H2,1-3H3 |
| InChIKey | NAODHSZMYZULDN-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 129.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|