C15H17NO4 — CID 17138410
5-[(2,5-dimethylanilino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 17138410) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is 5-[(2,5-dimethylanilino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(2,5-dimethylanilino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 17138410 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 5-[(2,5-dimethylanilino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | Cc1ccc(C)c(NC=C2C(=O)OC(C)(C)OC2=O)c1 |
| InChI | InChI=1S/C15H17NO4/c1-9-5-6-10(2)12(7-9)16-8-11-13(17)19-15(3,4)20-14(11)18/h5-8,16H,1-4H3 |
| InChIKey | QKTIIJUVHAXOOB-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|