About 1-methylpteridin-7-imine
1-methylpteridin-7-imine (PubChem CID 171384189) has the molecular formula C7H7N5
and a molecular weight of 161.17 g/mol. Its IUPAC name is 1-methylpteridin-7-imine.
Molecular Properties
| Compound Name | 1-methylpteridin-7-imine |
| PubChem CID | 171384189 |
| Molecular Formula | C7H7N5 |
| Molecular Weight | 161.17 g/mol |
| Exact Mass | 161.07 |
| IUPAC Name | 1-methylpteridin-7-imine |
| SMILES | [H]/N=c1\cnc2cncn(C)c-2n1 |
| InChI | InChI=1S/C7H7N5/c1-12-4-9-2-5-7(12)11-6(8)3-10-5/h2-4,8H,1H3/b8-6+ |
| InChIKey | INAQVVVZBBUBGG-SOFGYWHQSA-N |
| XLogP | -0.21 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.17 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-methylpteridin-7-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpteridin-7-imine?
The IUPAC name of 1-methylpteridin-7-imine (CID 171384189) is 1-methylpteridin-7-imine.
What is the SMILES notation for 1-methylpteridin-7-imine?
The canonical SMILES for 1-methylpteridin-7-imine is [H]/N=c1\cnc2cncn(C)c-2n1.
What is the InChIKey of 1-methylpteridin-7-imine?
The InChIKey is INAQVVVZBBUBGG-SOFGYWHQSA-N. The full InChI is InChI=1S/C7H7N5/c1-12-4-9-2-5-7(12)11-6(8)3-10-5/h2-4,8H,1H3/b8-6+.
What are the key properties of 1-methylpteridin-7-imine?
1-methylpteridin-7-imine has a molecular weight of 161.17 g/mol, XLogP of -0.21, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpteridin-7-imine is sourced from PubChem (CID 171384189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).