About (2S)-6-amino-2-[(4-methylphenyl)sulfonylamino]hexanamide;hydrobromide
(2S)-6-amino-2-[(4-methylphenyl)sulfonylamino]hexanamide;hydrobromide (PubChem CID 171384260) has the molecular formula C13H22BrN3O3S
and a molecular weight of 380.31 g/mol. Its IUPAC name is (2S)-6-amino-2-[(4-methylphenyl)sulfonylamino]hexanamide;hydrobromide.
Molecular Properties
| Compound Name | (2S)-6-amino-2-[(4-methylphenyl)sulfonylamino]hexanamide;hydrobromide |
| PubChem CID | 171384260 |
| Molecular Formula | C13H22BrN3O3S |
| Molecular Weight | 380.31 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | (2S)-6-amino-2-[(4-methylphenyl)sulfonylamino]hexanamide;hydrobromide |
| SMILES | Br.Cc1ccc(S(=O)(=O)N[C@@H](CCCCN)C(N)=O)cc1 |
| InChI | InChI=1S/C13H21N3O3S.BrH/c1-10-5-7-11(8-6-10)20(18,19)16-12(13(15)17)4-2-3-9-14;/h5-8,12,16H,2-4,9,14H2,1H3,(H2,15,17);1H/t12-;/m0./s1 |
| InChIKey | XSGCVYFUFYKIJP-YDALLXLXSA-N |
| XLogP | 0.83 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.31 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2S)-6-amino-2-[(4-methylphenyl)sulfonylamino]hexanamide;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-6-amino-2-[(4-methylphenyl)sulfonylamino]hexanamide;hydrobromide?
The IUPAC name of (2S)-6-amino-2-[(4-methylphenyl)sulfonylamino]hexanamide;hydrobromide (CID 171384260) is (2S)-6-amino-2-[(4-methylphenyl)sulfonylamino]hexanamide;hydrobromide.
What is the SMILES notation for (2S)-6-amino-2-[(4-methylphenyl)sulfonylamino]hexanamide;hydrobromide?
The canonical SMILES for (2S)-6-amino-2-[(4-methylphenyl)sulfonylamino]hexanamide;hydrobromide is Br.Cc1ccc(S(=O)(=O)N[C@@H](CCCCN)C(N)=O)cc1.
What is the InChIKey of (2S)-6-amino-2-[(4-methylphenyl)sulfonylamino]hexanamide;hydrobromide?
The InChIKey is XSGCVYFUFYKIJP-YDALLXLXSA-N. The full InChI is InChI=1S/C13H21N3O3S.BrH/c1-10-5-7-11(8-6-10)20(18,19)16-12(13(15)17)4-2-3-9-14;/h5-8,12,16H,2-4,9,14H2,1H3,(H2,15,17);1H/t12-;/m0./s1.
What are the key properties of (2S)-6-amino-2-[(4-methylphenyl)sulfonylamino]hexanamide;hydrobromide?
(2S)-6-amino-2-[(4-methylphenyl)sulfonylamino]hexanamide;hydrobromide has a molecular weight of 380.31 g/mol, XLogP of 0.83, 8 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-6-amino-2-[(4-methylphenyl)sulfonylamino]hexanamide;hydrobromide is sourced from PubChem (CID 171384260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).