About 2-amino-8-methyl-6-(2-oxopropyl)-3,7-dihydropteridin-4-one
2-amino-8-methyl-6-(2-oxopropyl)-3,7-dihydropteridin-4-one (PubChem CID 171384274) has the molecular formula C10H13N5O2
and a molecular weight of 235.25 g/mol. Its IUPAC name is 2-amino-8-methyl-6-(2-oxopropyl)-3,7-dihydropteridin-4-one.
Molecular Properties
| Compound Name | 2-amino-8-methyl-6-(2-oxopropyl)-3,7-dihydropteridin-4-one |
| PubChem CID | 171384274 |
| Molecular Formula | C10H13N5O2 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 2-amino-8-methyl-6-(2-oxopropyl)-3,7-dihydropteridin-4-one |
| SMILES | CC(=O)CC1=Nc2c(nc(N)[nH]c2=O)N(C)C1 |
| InChI | InChI=1S/C10H13N5O2/c1-5(16)3-6-4-15(2)8-7(12-6)9(17)14-10(11)13-8/h3-4H2,1-2H3,(H3,11,13,14,17) |
| InChIKey | DPNHCYIXKVMMKJ-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 104.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-amino-8-methyl-6-(2-oxopropyl)-3,7-dihydropteridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-8-methyl-6-(2-oxopropyl)-3,7-dihydropteridin-4-one?
The IUPAC name of 2-amino-8-methyl-6-(2-oxopropyl)-3,7-dihydropteridin-4-one (CID 171384274) is 2-amino-8-methyl-6-(2-oxopropyl)-3,7-dihydropteridin-4-one.
What is the SMILES notation for 2-amino-8-methyl-6-(2-oxopropyl)-3,7-dihydropteridin-4-one?
The canonical SMILES for 2-amino-8-methyl-6-(2-oxopropyl)-3,7-dihydropteridin-4-one is CC(=O)CC1=Nc2c(nc(N)[nH]c2=O)N(C)C1.
What is the InChIKey of 2-amino-8-methyl-6-(2-oxopropyl)-3,7-dihydropteridin-4-one?
The InChIKey is DPNHCYIXKVMMKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N5O2/c1-5(16)3-6-4-15(2)8-7(12-6)9(17)14-10(11)13-8/h3-4H2,1-2H3,(H3,11,13,14,17).
What are the key properties of 2-amino-8-methyl-6-(2-oxopropyl)-3,7-dihydropteridin-4-one?
2-amino-8-methyl-6-(2-oxopropyl)-3,7-dihydropteridin-4-one has a molecular weight of 235.25 g/mol, XLogP of -0.15, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-8-methyl-6-(2-oxopropyl)-3,7-dihydropteridin-4-one is sourced from PubChem (CID 171384274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).